C12H12FNO2 — CID 117126986
7-fluorospiro[1-benzofuran-3,4'-piperidine]-2-one (PubChem CID 117126986) has the molecular formula C12H12FNO2 and a molecular weight of 221.23 g/mol. Its IUPAC name is 7-fluorospiro[1-benzofuran-3,4'-piperidine]-2-one.
| Compound Name | 7-fluorospiro[1-benzofuran-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 117126986 |
| Molecular Formula | C12H12FNO2 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 7-fluorospiro[1-benzofuran-3,4'-piperidine]-2-one |
| SMILES | O=C1Oc2c(F)cccc2C12CCNCC2 |
| InChI | InChI=1S/C12H12FNO2/c13-9-3-1-2-8-10(9)16-11(15)12(8)4-6-14-7-5-12/h1-3,14H,4-7H2 |
| InChIKey | DGEPAMJQUGGAJR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|