C21H26N4O2 — CID 138594229
2-(7-methoxyspiro[1,2-dihydroindole-3,4'-piperidine]-1'-yl)-5,6,7,8-tetrahydro-3H-quinazolin-4-one (PubChem CID 138594229) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 2-(7-methoxyspiro[1,2-dihydroindole-3,4'-piperidine]-1'-yl)-5,6,7,8-tetrahydro-3H-quinazolin-4-one.
| Compound Name | 2-(7-methoxyspiro[1,2-dihydroindole-3,4'-piperidine]-1'-yl)-5,6,7,8-tetrahydro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 138594229 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 2-(7-methoxyspiro[1,2-dihydroindole-3,4'-piperidine]-1'-yl)-5,6,7,8-tetrahydro-3H-quinazolin-4-one |
| SMILES | COc1cccc2c1NCC21CCN(c2nc3c(c(=O)[nH]2)CCCC3)CC1 |
| InChI | InChI=1S/C21H26N4O2/c1-27-17-8-4-6-15-18(17)22-13-21(15)9-11-25(12-10-21)20-23-16-7-3-2-5-14(16)19(26)24-20/h4,6,8,22H,2-3,5,7,9-13H2,1H3,(H,23,24,26) |
| InChIKey | WTIBTCYZOPZLMR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |