About 5-methoxyspiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclohexane]
5-methoxyspiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclohexane] (PubChem CID 82128708) has the molecular formula C15H21NO
and a molecular weight of 231.34 g/mol. Its IUPAC name is 5-methoxyspiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclohexane].
Molecular Properties
| Compound Name | 5-methoxyspiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclohexane] |
| PubChem CID | 82128708 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 5-methoxyspiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclohexane] |
| SMILES | COc1cccc2c1C1(CCCCC1)CNC2 |
| InChI | InChI=1S/C15H21NO/c1-17-13-7-5-6-12-10-16-11-15(14(12)13)8-3-2-4-9-15/h5-7,16H,2-4,8-11H2,1H3 |
| InChIKey | HSJUASITEWSTMV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methoxyspiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclohexane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxyspiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclohexane]?
The IUPAC name of 5-methoxyspiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclohexane] (CID 82128708) is 5-methoxyspiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclohexane].
What is the SMILES notation for 5-methoxyspiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclohexane]?
The canonical SMILES for 5-methoxyspiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclohexane] is COc1cccc2c1C1(CCCCC1)CNC2.
What is the InChIKey of 5-methoxyspiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclohexane]?
The InChIKey is HSJUASITEWSTMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO/c1-17-13-7-5-6-12-10-16-11-15(14(12)13)8-3-2-4-9-15/h5-7,16H,2-4,8-11H2,1H3.
What are the key properties of 5-methoxyspiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclohexane]?
5-methoxyspiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclohexane] has a molecular weight of 231.34 g/mol, XLogP of 3.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxyspiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclohexane] is sourced from PubChem (CID 82128708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).