C14H18OS — CID 90137329
7-methoxyspiro[3H-1-benzothiophene-2,1'-cyclohexane] (PubChem CID 90137329) has the molecular formula C14H18OS and a molecular weight of 234.36 g/mol. Its IUPAC name is 7-methoxyspiro[3H-1-benzothiophene-2,1'-cyclohexane].
| Compound Name | 7-methoxyspiro[3H-1-benzothiophene-2,1'-cyclohexane] |
|---|---|
| PubChem CID | 90137329 |
| Molecular Formula | C14H18OS |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 7-methoxyspiro[3H-1-benzothiophene-2,1'-cyclohexane] |
| SMILES | COc1cccc2c1SC1(CCCCC1)C2 |
| InChI | InChI=1S/C14H18OS/c1-15-12-7-5-6-11-10-14(16-13(11)12)8-3-2-4-9-14/h5-7H,2-4,8-10H2,1H3 |
| InChIKey | JIPWSHSMYNRQOV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |