C7H6OS — CID 172854405
2-methoxy-7-thiabicyclo[4.1.0]hepta-1,3,5-triene (PubChem CID 172854405) has the molecular formula C7H6OS and a molecular weight of 138.19 g/mol. Its IUPAC name is 2-methoxy-7-thiabicyclo[4.1.0]hepta-1,3,5-triene.
| Compound Name | 2-methoxy-7-thiabicyclo[4.1.0]hepta-1,3,5-triene |
|---|---|
| PubChem CID | 172854405 |
| Molecular Formula | C7H6OS |
| Molecular Weight | 138.19 g/mol |
| Exact Mass | 138.01 |
| IUPAC Name | 2-methoxy-7-thiabicyclo[4.1.0]hepta-1,3,5-triene |
| SMILES | COc1cccc2c1S2 |
| InChI | InChI=1S/C7H6OS/c1-8-5-3-2-4-6-7(5)9-6/h2-4H,1H3 |
| InChIKey | YMQJIODYSWQVBP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.19 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|