C8H8O2S3 — CID 14939760
4,7-dimethoxy-1,2,3-benzotrithiole (PubChem CID 14939760) has the molecular formula C8H8O2S3 and a molecular weight of 232.35 g/mol. Its IUPAC name is 4,7-dimethoxy-1,2,3-benzotrithiole.
| Compound Name | 4,7-dimethoxy-1,2,3-benzotrithiole |
|---|---|
| PubChem CID | 14939760 |
| Molecular Formula | C8H8O2S3 |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 231.97 |
| IUPAC Name | 4,7-dimethoxy-1,2,3-benzotrithiole |
| SMILES | COc1ccc(OC)c2c1SSS2 |
| InChI | InChI=1S/C8H8O2S3/c1-9-5-3-4-6(10-2)8-7(5)11-13-12-8/h3-4H,1-2H3 |
| InChIKey | QHODZYJQOLGXIS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|