C20H24O2S4 — CID 102239647
4,7-dimethoxy-1,10-di(propan-2-yl)benzo[c][1,2,5,6]benzotetrathiocine (PubChem CID 102239647) has the molecular formula C20H24O2S4 and a molecular weight of 424.68 g/mol. Its IUPAC name is 4,7-dimethoxy-1,10-di(propan-2-yl)benzo[c][1,2,5,6]benzotetrathiocine.
| Compound Name | 4,7-dimethoxy-1,10-di(propan-2-yl)benzo[c][1,2,5,6]benzotetrathiocine |
|---|---|
| PubChem CID | 102239647 |
| Molecular Formula | C20H24O2S4 |
| Molecular Weight | 424.68 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 4,7-dimethoxy-1,10-di(propan-2-yl)benzo[c][1,2,5,6]benzotetrathiocine |
| SMILES | COc1ccc(C(C)C)c2c1SSc1c(OC)ccc(C(C)C)c1SS2 |
| InChI | InChI=1S/C20H24O2S4/c1-11(2)13-7-9-15(21-5)19-17(13)23-24-18-14(12(3)4)8-10-16(22-6)20(18)26-25-19/h7-12H,1-6H3 |
| InChIKey | DYBQDNVWFMWKGK-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.68 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|