About CID 23246120
CID 23246120 (PubChem CID 23246120) has the molecular formula C10H12OSe2
and a molecular weight of 306.13 g/mol.
Molecular Properties
| Compound Name | CID 23246120 |
| PubChem CID | 23246120 |
| Molecular Formula | C10H12OSe2 |
| Molecular Weight | 306.13 g/mol |
| Exact Mass | 307.92 |
| IUPAC Name | — |
| SMILES | COc1ccc(C(C)C)c([Se])c1[Se] |
| InChI | InChI=1S/C10H12OSe2/c1-6(2)7-4-5-8(11-3)10(13)9(7)12/h4-6H,1-3H3 |
| InChIKey | MZEWRIOXWWLRKQ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.13 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 23246120 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23246120?
The IUPAC name of CID 23246120 (CID 23246120) is not available.
What is the SMILES notation for CID 23246120?
The canonical SMILES for CID 23246120 is COc1ccc(C(C)C)c([Se])c1[Se].
What is the InChIKey of CID 23246120?
The InChIKey is MZEWRIOXWWLRKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12OSe2/c1-6(2)7-4-5-8(11-3)10(13)9(7)12/h4-6H,1-3H3.
What are the key properties of CID 23246120?
CID 23246120 has a molecular weight of 306.13 g/mol, XLogP of 0.41, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23246120 is sourced from PubChem (CID 23246120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).