C24H19Cl3O2 — CID 2202790
1-methoxy-4-[2,2,2-trichloro-1-(4-methoxynaphthalen-1-yl)ethyl]naphthalene (PubChem CID 2202790) has the molecular formula C24H19Cl3O2 and a molecular weight of 445.77 g/mol. Its IUPAC name is 1-methoxy-4-[2,2,2-trichloro-1-(4-methoxynaphthalen-1-yl)ethyl]naphthalene.
| Compound Name | 1-methoxy-4-[2,2,2-trichloro-1-(4-methoxynaphthalen-1-yl)ethyl]naphthalene |
|---|---|
| PubChem CID | 2202790 |
| Molecular Formula | C24H19Cl3O2 |
| Molecular Weight | 445.77 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | 1-methoxy-4-[2,2,2-trichloro-1-(4-methoxynaphthalen-1-yl)ethyl]naphthalene |
| SMILES | COc1ccc(C(c2ccc(OC)c3ccccc23)C(Cl)(Cl)Cl)c2ccccc12 |
| InChI | InChI=1S/C24H19Cl3O2/c1-28-21-13-11-19(15-7-3-5-9-17(15)21)23(24(25,26)27)20-12-14-22(29-2)18-10-6-4-8-16(18)20/h3-14,23H,1-2H3 |
| InChIKey | HMGXVZSWETYLDB-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.77 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|