C27H26O3 — CID 151420468
2,4-bis(4-methoxynaphthalen-1-yl)pentan-3-one (PubChem CID 151420468) has the molecular formula C27H26O3 and a molecular weight of 398.50 g/mol. Its IUPAC name is 2,4-bis(4-methoxynaphthalen-1-yl)pentan-3-one.
| Compound Name | 2,4-bis(4-methoxynaphthalen-1-yl)pentan-3-one |
|---|---|
| PubChem CID | 151420468 |
| Molecular Formula | C27H26O3 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 2,4-bis(4-methoxynaphthalen-1-yl)pentan-3-one |
| SMILES | COc1ccc(C(C)C(=O)C(C)c2ccc(OC)c3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C27H26O3/c1-17(19-13-15-25(29-3)23-11-7-5-9-21(19)23)27(28)18(2)20-14-16-26(30-4)24-12-8-6-10-22(20)24/h5-18H,1-4H3 |
| InChIKey | PAKUXXLCZHOWSL-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |