C16H20O2 — CID 61101734
1-(4-methoxynaphthalen-1-yl)-2,2-dimethylpropan-1-ol (PubChem CID 61101734) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 1-(4-methoxynaphthalen-1-yl)-2,2-dimethylpropan-1-ol.
| Compound Name | 1-(4-methoxynaphthalen-1-yl)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 61101734 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 1-(4-methoxynaphthalen-1-yl)-2,2-dimethylpropan-1-ol |
| SMILES | COc1ccc(C(O)C(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C16H20O2/c1-16(2,3)15(17)13-9-10-14(18-4)12-8-6-5-7-11(12)13/h5-10,15,17H,1-4H3 |
| InChIKey | VQOVTAZICKMORW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |