C20H24O2S2Se2 — CID 102239653
1,10-dimethoxy-4,7-di(propan-2-yl)benzo[c][1,2,5,6]benzodithiadiselenocine (PubChem CID 102239653) has the molecular formula C20H24O2S2Se2 and a molecular weight of 518.46 g/mol. Its IUPAC name is 1,10-dimethoxy-4,7-di(propan-2-yl)benzo[c][1,2,5,6]benzodithiadiselenocine.
| Compound Name | 1,10-dimethoxy-4,7-di(propan-2-yl)benzo[c][1,2,5,6]benzodithiadiselenocine |
|---|---|
| PubChem CID | 102239653 |
| Molecular Formula | C20H24O2S2Se2 |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 519.95 |
| IUPAC Name | 1,10-dimethoxy-4,7-di(propan-2-yl)benzo[c][1,2,5,6]benzodithiadiselenocine |
| SMILES | COc1ccc(C(C)C)c2c1[Se][Se]c1c(OC)ccc(C(C)C)c1SS2 |
| InChI | InChI=1S/C20H24O2S2Se2/c1-11(2)13-7-9-15(21-5)19-17(13)23-24-18-14(12(3)4)8-10-16(22-6)20(18)26-25-19/h7-12H,1-6H3 |
| InChIKey | OVNLIIVOORTHKG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|