C26H36O2S2Se2 — CID 102239666
1,7-dibutoxy-4,10-di(propan-2-yl)benzo[c][1,5,2,6]benzodithiadiselenocine (PubChem CID 102239666) has the molecular formula C26H36O2S2Se2 and a molecular weight of 602.63 g/mol. Its IUPAC name is 1,7-dibutoxy-4,10-di(propan-2-yl)benzo[c][1,5,2,6]benzodithiadiselenocine.
| Compound Name | 1,7-dibutoxy-4,10-di(propan-2-yl)benzo[c][1,5,2,6]benzodithiadiselenocine |
|---|---|
| PubChem CID | 102239666 |
| Molecular Formula | C26H36O2S2Se2 |
| Molecular Weight | 602.63 g/mol |
| Exact Mass | 604.05 |
| IUPAC Name | 1,7-dibutoxy-4,10-di(propan-2-yl)benzo[c][1,5,2,6]benzodithiadiselenocine |
| SMILES | CCCCOc1ccc(C(C)C)c2c1[Se]Sc1c(C(C)C)ccc(OCCCC)c1[Se]S2 |
| InChI | InChI=1S/C26H36O2S2Se2/c1-7-9-15-27-21-13-11-19(17(3)4)23-25(21)31-30-24-20(18(5)6)12-14-22(26(24)32-29-23)28-16-10-8-2/h11-14,17-18H,7-10,15-16H2,1-6H3 |
| InChIKey | NTKKIXCISHUYON-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.63 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|