C12H16O2S2Se — CID 134997086
4,7-dipropoxy-1,2,3-benzodithiaselenole (PubChem CID 134997086) has the molecular formula C12H16O2S2Se and a molecular weight of 335.35 g/mol. Its IUPAC name is 4,7-dipropoxy-1,2,3-benzodithiaselenole.
| Compound Name | 4,7-dipropoxy-1,2,3-benzodithiaselenole |
|---|---|
| PubChem CID | 134997086 |
| Molecular Formula | C12H16O2S2Se |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | 4,7-dipropoxy-1,2,3-benzodithiaselenole |
| SMILES | CCCOc1ccc(OCCC)c2c1SS[Se]2 |
| InChI | InChI=1S/C12H16O2S2Se/c1-3-7-13-9-5-6-10(14-8-4-2)12-11(9)15-16-17-12/h5-6H,3-4,7-8H2,1-2H3 |
| InChIKey | CLMRQJWBYZTBGG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|