C10H16O2S — CID 18915039
2,5-dipropoxythiophene (PubChem CID 18915039) has the molecular formula C10H16O2S and a molecular weight of 200.30 g/mol. Its IUPAC name is 2,5-dipropoxythiophene.
| Compound Name | 2,5-dipropoxythiophene |
|---|---|
| PubChem CID | 18915039 |
| Molecular Formula | C10H16O2S |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 2,5-dipropoxythiophene |
| SMILES | CCCOc1ccc(OCCC)s1 |
| InChI | InChI=1S/C10H16O2S/c1-3-7-11-9-5-6-10(13-9)12-8-4-2/h5-6H,3-4,7-8H2,1-2H3 |
| InChIKey | RMIZAVYLNILOBA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |