C13H14ClNO2S — CID 79764860
2-chloro-5-[(4-propoxyphenoxy)methyl]-1,3-thiazole (PubChem CID 79764860) has the molecular formula C13H14ClNO2S and a molecular weight of 283.78 g/mol. Its IUPAC name is 2-chloro-5-[(4-propoxyphenoxy)methyl]-1,3-thiazole.
| Compound Name | 2-chloro-5-[(4-propoxyphenoxy)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 79764860 |
| Molecular Formula | C13H14ClNO2S |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 2-chloro-5-[(4-propoxyphenoxy)methyl]-1,3-thiazole |
| SMILES | CCCOc1ccc(OCc2cnc(Cl)s2)cc1 |
| InChI | InChI=1S/C13H14ClNO2S/c1-2-7-16-10-3-5-11(6-4-10)17-9-12-8-15-13(14)18-12/h3-6,8H,2,7,9H2,1H3 |
| InChIKey | QDGLEEBIOSZKMA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |