C15H17ClN2O2S — CID 166187595
4-[(2-chloro-1,3-thiazol-5-yl)methoxy]-N,N-diethylbenzamide (PubChem CID 166187595) has the molecular formula C15H17ClN2O2S and a molecular weight of 324.83 g/mol. Its IUPAC name is 4-[(2-chloro-1,3-thiazol-5-yl)methoxy]-N,N-diethylbenzamide.
| Compound Name | 4-[(2-chloro-1,3-thiazol-5-yl)methoxy]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 166187595 |
| Molecular Formula | C15H17ClN2O2S |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 4-[(2-chloro-1,3-thiazol-5-yl)methoxy]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(OCc2cnc(Cl)s2)cc1 |
| InChI | InChI=1S/C15H17ClN2O2S/c1-3-18(4-2)14(19)11-5-7-12(8-6-11)20-10-13-9-17-15(16)21-13/h5-9H,3-4,10H2,1-2H3 |
| InChIKey | GZFFYFMJQMKKNT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |