C10H16ClNOS — CID 79765509
2-chloro-5-(hexoxymethyl)-1,3-thiazole (PubChem CID 79765509) has the molecular formula C10H16ClNOS and a molecular weight of 233.76 g/mol. Its IUPAC name is 2-chloro-5-(hexoxymethyl)-1,3-thiazole.
| Compound Name | 2-chloro-5-(hexoxymethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 79765509 |
| Molecular Formula | C10H16ClNOS |
| Molecular Weight | 233.76 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 2-chloro-5-(hexoxymethyl)-1,3-thiazole |
| SMILES | CCCCCCOCc1cnc(Cl)s1 |
| InChI | InChI=1S/C10H16ClNOS/c1-2-3-4-5-6-13-8-9-7-12-10(11)14-9/h7H,2-6,8H2,1H3 |
| InChIKey | NHJXRVRWDKRHFJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.76 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|