C13H24N2O3S — CID 103180550
5-[2-(3-methoxypropoxy)ethoxymethyl]-N-propyl-1,3-thiazol-2-amine (PubChem CID 103180550) has the molecular formula C13H24N2O3S and a molecular weight of 288.41 g/mol. Its IUPAC name is 5-[2-(3-methoxypropoxy)ethoxymethyl]-N-propyl-1,3-thiazol-2-amine.
| Compound Name | 5-[2-(3-methoxypropoxy)ethoxymethyl]-N-propyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 103180550 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 5-[2-(3-methoxypropoxy)ethoxymethyl]-N-propyl-1,3-thiazol-2-amine |
| SMILES | CCCNc1ncc(COCCOCCCOC)s1 |
| InChI | InChI=1S/C13H24N2O3S/c1-3-5-14-13-15-10-12(19-13)11-18-9-8-17-7-4-6-16-2/h10H,3-9,11H2,1-2H3,(H,14,15) |
| InChIKey | NHROMHFBDKYVIR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|