C15H28N2OS — CID 79774300
5-(octan-2-yloxymethyl)-N-propyl-1,3-thiazol-2-amine (PubChem CID 79774300) has the molecular formula C15H28N2OS and a molecular weight of 284.47 g/mol. Its IUPAC name is 5-(octan-2-yloxymethyl)-N-propyl-1,3-thiazol-2-amine.
| Compound Name | 5-(octan-2-yloxymethyl)-N-propyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79774300 |
| Molecular Formula | C15H28N2OS |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 5-(octan-2-yloxymethyl)-N-propyl-1,3-thiazol-2-amine |
| SMILES | CCCCCCC(C)OCc1cnc(NCCC)s1 |
| InChI | InChI=1S/C15H28N2OS/c1-4-6-7-8-9-13(3)18-12-14-11-17-15(19-14)16-10-5-2/h11,13H,4-10,12H2,1-3H3,(H,16,17) |
| InChIKey | OSFYGDGXTTXKFV-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|