C9H12ClNO2S — CID 79764859
2-chloro-5-(oxolan-2-ylmethoxymethyl)-1,3-thiazole (PubChem CID 79764859) has the molecular formula C9H12ClNO2S and a molecular weight of 233.72 g/mol. Its IUPAC name is 2-chloro-5-(oxolan-2-ylmethoxymethyl)-1,3-thiazole.
| Compound Name | 2-chloro-5-(oxolan-2-ylmethoxymethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 79764859 |
| Molecular Formula | C9H12ClNO2S |
| Molecular Weight | 233.72 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 2-chloro-5-(oxolan-2-ylmethoxymethyl)-1,3-thiazole |
| SMILES | Clc1ncc(COCC2CCCO2)s1 |
| InChI | InChI=1S/C9H12ClNO2S/c10-9-11-4-8(14-9)6-12-5-7-2-1-3-13-7/h4,7H,1-3,5-6H2 |
| InChIKey | PPMZXHNUHBWECM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.72 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |