C14H22N2O2 — CID 62194442
5-(oxolan-2-ylmethoxymethyl)-N-propylpyridin-2-amine (PubChem CID 62194442) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 5-(oxolan-2-ylmethoxymethyl)-N-propylpyridin-2-amine.
| Compound Name | 5-(oxolan-2-ylmethoxymethyl)-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 62194442 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 5-(oxolan-2-ylmethoxymethyl)-N-propylpyridin-2-amine |
| SMILES | CCCNc1ccc(COCC2CCCO2)cn1 |
| InChI | InChI=1S/C14H22N2O2/c1-2-7-15-14-6-5-12(9-16-14)10-17-11-13-4-3-8-18-13/h5-6,9,13H,2-4,7-8,10-11H2,1H3,(H,15,16) |
| InChIKey | HZCSHHIFUZDDLJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |