C14H18N2OS — CID 55044939
N-propyl-5-(thiophen-2-ylmethoxymethyl)pyridin-2-amine (PubChem CID 55044939) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is N-propyl-5-(thiophen-2-ylmethoxymethyl)pyridin-2-amine.
| Compound Name | N-propyl-5-(thiophen-2-ylmethoxymethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 55044939 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | N-propyl-5-(thiophen-2-ylmethoxymethyl)pyridin-2-amine |
| SMILES | CCCNc1ccc(COCc2cccs2)cn1 |
| InChI | InChI=1S/C14H18N2OS/c1-2-7-15-14-6-5-12(9-16-14)10-17-11-13-4-3-8-18-13/h3-6,8-9H,2,7,10-11H2,1H3,(H,15,16) |
| InChIKey | RCPCZJJHFKPWJE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |