C15H19N3OS — CID 80962779
2-cyclopropyl-N-propyl-6-(thiophen-2-ylmethoxy)pyrimidin-4-amine (PubChem CID 80962779) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is 2-cyclopropyl-N-propyl-6-(thiophen-2-ylmethoxy)pyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-N-propyl-6-(thiophen-2-ylmethoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80962779 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-cyclopropyl-N-propyl-6-(thiophen-2-ylmethoxy)pyrimidin-4-amine |
| SMILES | CCCNc1cc(OCc2cccs2)nc(C2CC2)n1 |
| InChI | InChI=1S/C15H19N3OS/c1-2-7-16-13-9-14(18-15(17-13)11-5-6-11)19-10-12-4-3-8-20-12/h3-4,8-9,11H,2,5-7,10H2,1H3,(H,16,17,18) |
| InChIKey | ODGDZKDFBSWCOC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |