C14H23N3O2 — CID 80965945
2-cyclopropyl-6-(2-ethoxyethoxy)-N-propylpyrimidin-4-amine (PubChem CID 80965945) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-cyclopropyl-6-(2-ethoxyethoxy)-N-propylpyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-6-(2-ethoxyethoxy)-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80965945 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 2-cyclopropyl-6-(2-ethoxyethoxy)-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1cc(OCCOCC)nc(C2CC2)n1 |
| InChI | InChI=1S/C14H23N3O2/c1-3-7-15-12-10-13(19-9-8-18-4-2)17-14(16-12)11-5-6-11/h10-11H,3-9H2,1-2H3,(H,15,16,17) |
| InChIKey | JNCKSXZXARGSIB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|