C17H31NOS — CID 107558214
N-[[5-(octoxymethyl)thiophen-2-yl]methyl]propan-2-amine (PubChem CID 107558214) has the molecular formula C17H31NOS and a molecular weight of 297.51 g/mol. Its IUPAC name is N-[[5-(octoxymethyl)thiophen-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[5-(octoxymethyl)thiophen-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 107558214 |
| Molecular Formula | C17H31NOS |
| Molecular Weight | 297.51 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | N-[[5-(octoxymethyl)thiophen-2-yl]methyl]propan-2-amine |
| SMILES | CCCCCCCCOCc1ccc(CNC(C)C)s1 |
| InChI | InChI=1S/C17H31NOS/c1-4-5-6-7-8-9-12-19-14-17-11-10-16(20-17)13-18-15(2)3/h10-11,15,18H,4-9,12-14H2,1-3H3 |
| InChIKey | CTHNPTXGTLMUPN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|