C13H16ClNOS — CID 145486679
2-chloro-5-[(3-methylphenoxy)methyl]-1,3-thiazole;ethane (PubChem CID 145486679) has the molecular formula C13H16ClNOS and a molecular weight of 269.80 g/mol. Its IUPAC name is 2-chloro-5-[(3-methylphenoxy)methyl]-1,3-thiazole;ethane.
| Compound Name | 2-chloro-5-[(3-methylphenoxy)methyl]-1,3-thiazole;ethane |
|---|---|
| PubChem CID | 145486679 |
| Molecular Formula | C13H16ClNOS |
| Molecular Weight | 269.80 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 2-chloro-5-[(3-methylphenoxy)methyl]-1,3-thiazole;ethane |
| SMILES | CC.Cc1cccc(OCc2cnc(Cl)s2)c1 |
| InChI | InChI=1S/C11H10ClNOS.C2H6/c1-8-3-2-4-9(5-8)14-7-10-6-13-11(12)15-10;1-2/h2-6H,7H2,1H3;1-2H3 |
| InChIKey | DKZMBQWUGRRXFH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.80 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |