C12H13NO2 — CID 117192249
2-methyl-5-[(3-methylphenoxy)methyl]-1,3-oxazole (PubChem CID 117192249) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 2-methyl-5-[(3-methylphenoxy)methyl]-1,3-oxazole.
| Compound Name | 2-methyl-5-[(3-methylphenoxy)methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 117192249 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 2-methyl-5-[(3-methylphenoxy)methyl]-1,3-oxazole |
| SMILES | Cc1cccc(OCc2cnc(C)o2)c1 |
| InChI | InChI=1S/C12H13NO2/c1-9-4-3-5-11(6-9)14-8-12-7-13-10(2)15-12/h3-7H,8H2,1-2H3 |
| InChIKey | CYLOKYPZJQMVEL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |