C11H11NO2S — CID 63020479
3-[(2-methyl-1,3-thiazol-5-yl)methoxy]phenol (PubChem CID 63020479) has the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. Its IUPAC name is 3-[(2-methyl-1,3-thiazol-5-yl)methoxy]phenol.
| Compound Name | 3-[(2-methyl-1,3-thiazol-5-yl)methoxy]phenol |
|---|---|
| PubChem CID | 63020479 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 3-[(2-methyl-1,3-thiazol-5-yl)methoxy]phenol |
| SMILES | Cc1ncc(COc2cccc(O)c2)s1 |
| InChI | InChI=1S/C11H11NO2S/c1-8-12-6-11(15-8)7-14-10-4-2-3-9(13)5-10/h2-6,13H,7H2,1H3 |
| InChIKey | DRNWCBNUCDXRSW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |