C17H25NO2SSi — CID 90075590
tert-butyl-dimethyl-[3-[(2-methyl-1,3-thiazol-5-yl)methoxy]phenoxy]silane (PubChem CID 90075590) has the molecular formula C17H25NO2SSi and a molecular weight of 335.55 g/mol. Its IUPAC name is tert-butyl-dimethyl-[3-[(2-methyl-1,3-thiazol-5-yl)methoxy]phenoxy]silane.
| Compound Name | tert-butyl-dimethyl-[3-[(2-methyl-1,3-thiazol-5-yl)methoxy]phenoxy]silane |
|---|---|
| PubChem CID | 90075590 |
| Molecular Formula | C17H25NO2SSi |
| Molecular Weight | 335.55 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | tert-butyl-dimethyl-[3-[(2-methyl-1,3-thiazol-5-yl)methoxy]phenoxy]silane |
| SMILES | Cc1ncc(COc2cccc(O[Si](C)(C)C(C)(C)C)c2)s1 |
| InChI | InChI=1S/C17H25NO2SSi/c1-13-18-11-16(21-13)12-19-14-8-7-9-15(10-14)20-22(5,6)17(2,3)4/h7-11H,12H2,1-6H3 |
| InChIKey | AJKAHMQEKZPKAM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.55 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|