C5H10Cl2N2OS — CID 155978412
O-[(2-methyl-1,3-thiazol-5-yl)methyl]hydroxylamine;dihydrochloride (PubChem CID 155978412) has the molecular formula C5H10Cl2N2OS and a molecular weight of 217.12 g/mol. Its IUPAC name is O-[(2-methyl-1,3-thiazol-5-yl)methyl]hydroxylamine;dihydrochloride.
| Compound Name | O-[(2-methyl-1,3-thiazol-5-yl)methyl]hydroxylamine;dihydrochloride |
|---|---|
| PubChem CID | 155978412 |
| Molecular Formula | C5H10Cl2N2OS |
| Molecular Weight | 217.12 g/mol |
| Exact Mass | 215.99 |
| IUPAC Name | O-[(2-methyl-1,3-thiazol-5-yl)methyl]hydroxylamine;dihydrochloride |
| SMILES | Cc1ncc(CON)s1.Cl.Cl |
| InChI | InChI=1S/C5H8N2OS.2ClH/c1-4-7-2-5(9-4)3-8-6;;/h2H,3,6H2,1H3;2*1H |
| InChIKey | OOGVZUZMBWTZPQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.12 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|