C5H7NS2 — CID 82514756
(2-methyl-1,3-thiazol-5-yl)methanethiol (PubChem CID 82514756) has the molecular formula C5H7NS2 and a molecular weight of 145.25 g/mol. Its IUPAC name is (2-methyl-1,3-thiazol-5-yl)methanethiol.
| Compound Name | (2-methyl-1,3-thiazol-5-yl)methanethiol |
|---|---|
| PubChem CID | 82514756 |
| Molecular Formula | C5H7NS2 |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.00 |
| IUPAC Name | (2-methyl-1,3-thiazol-5-yl)methanethiol |
| SMILES | Cc1ncc(CS)s1 |
| InChI | InChI=1S/C5H7NS2/c1-4-6-2-5(3-7)8-4/h2,7H,3H2,1H3 |
| InChIKey | VBGMTSIXCKNGSX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|