C14H17NS2 — CID 82424310
[2-(4-tert-butylphenyl)-1,3-thiazol-5-yl]methanethiol (PubChem CID 82424310) has the molecular formula C14H17NS2 and a molecular weight of 263.43 g/mol. Its IUPAC name is [2-(4-tert-butylphenyl)-1,3-thiazol-5-yl]methanethiol.
| Compound Name | [2-(4-tert-butylphenyl)-1,3-thiazol-5-yl]methanethiol |
|---|---|
| PubChem CID | 82424310 |
| Molecular Formula | C14H17NS2 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | [2-(4-tert-butylphenyl)-1,3-thiazol-5-yl]methanethiol |
| SMILES | CC(C)(C)c1ccc(-c2ncc(CS)s2)cc1 |
| InChI | InChI=1S/C14H17NS2/c1-14(2,3)11-6-4-10(5-7-11)13-15-8-12(9-16)17-13/h4-8,16H,9H2,1-3H3 |
| InChIKey | VIHBETRPVXVKPU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|