C10H7F2NS2 — CID 82422702
[2-(2,6-difluorophenyl)-1,3-thiazol-5-yl]methanethiol (PubChem CID 82422702) has the molecular formula C10H7F2NS2 and a molecular weight of 243.30 g/mol. Its IUPAC name is [2-(2,6-difluorophenyl)-1,3-thiazol-5-yl]methanethiol.
| Compound Name | [2-(2,6-difluorophenyl)-1,3-thiazol-5-yl]methanethiol |
|---|---|
| PubChem CID | 82422702 |
| Molecular Formula | C10H7F2NS2 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.00 |
| IUPAC Name | [2-(2,6-difluorophenyl)-1,3-thiazol-5-yl]methanethiol |
| SMILES | Fc1cccc(F)c1-c1ncc(CS)s1 |
| InChI | InChI=1S/C10H7F2NS2/c11-7-2-1-3-8(12)9(7)10-13-4-6(5-14)15-10/h1-4,14H,5H2 |
| InChIKey | JEJGTSQRGASUDT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|