C10H9FN2S — CID 61280947
[2-(3-fluorophenyl)-1,3-thiazol-5-yl]methanamine (PubChem CID 61280947) has the molecular formula C10H9FN2S and a molecular weight of 208.26 g/mol. Its IUPAC name is [2-(3-fluorophenyl)-1,3-thiazol-5-yl]methanamine.
| Compound Name | [2-(3-fluorophenyl)-1,3-thiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 61280947 |
| Molecular Formula | C10H9FN2S |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | [2-(3-fluorophenyl)-1,3-thiazol-5-yl]methanamine |
| SMILES | NCc1cnc(-c2cccc(F)c2)s1 |
| InChI | InChI=1S/C10H9FN2S/c11-8-3-1-2-7(4-8)10-13-6-9(5-12)14-10/h1-4,6H,5,12H2 |
| InChIKey | HGRVVNPPBBVNEN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |