C12H6F4 — CID 13068684
2-(2,6-difluorophenyl)-1,3-difluorobenzene (PubChem CID 13068684) has the molecular formula C12H6F4 and a molecular weight of 226.17 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-1,3-difluorobenzene.
| Compound Name | 2-(2,6-difluorophenyl)-1,3-difluorobenzene |
|---|---|
| PubChem CID | 13068684 |
| Molecular Formula | C12H6F4 |
| Molecular Weight | 226.17 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 2-(2,6-difluorophenyl)-1,3-difluorobenzene |
| SMILES | Fc1cccc(F)c1-c1c(F)cccc1F |
| InChI | InChI=1S/C12H6F4/c13-7-3-1-4-8(14)11(7)12-9(15)5-2-6-10(12)16/h1-6H |
| InChIKey | ZLWVAKVIJUXDTO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.17 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |