About (2,6-difluorophenyl)alumane
(2,6-difluorophenyl)alumane (PubChem CID 175341718) has the molecular formula C6H5AlF2
and a molecular weight of 142.08 g/mol. Its IUPAC name is (2,6-difluorophenyl)alumane.
Molecular Properties
| Compound Name | (2,6-difluorophenyl)alumane |
| PubChem CID | 175341718 |
| Molecular Formula | C6H5AlF2 |
| Molecular Weight | 142.08 g/mol |
| Exact Mass | 142.02 |
| IUPAC Name | (2,6-difluorophenyl)alumane |
| SMILES | Fc1cccc(F)c1[AlH2] |
| InChI | InChI=1S/C6H3F2.Al.2H/c7-5-2-1-3-6(8)4-5;;;/h1-3H;;; |
| InChIKey | PHSYSROGLFFNAW-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.08 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (2,6-difluorophenyl)alumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-difluorophenyl)alumane?
The IUPAC name of (2,6-difluorophenyl)alumane (CID 175341718) is (2,6-difluorophenyl)alumane.
What is the SMILES notation for (2,6-difluorophenyl)alumane?
The canonical SMILES for (2,6-difluorophenyl)alumane is Fc1cccc(F)c1[AlH2].
What is the InChIKey of (2,6-difluorophenyl)alumane?
The InChIKey is PHSYSROGLFFNAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F2.Al.2H/c7-5-2-1-3-6(8)4-5;;;/h1-3H;;;.
What are the key properties of (2,6-difluorophenyl)alumane?
(2,6-difluorophenyl)alumane has a molecular weight of 142.08 g/mol, XLogP of 0.22, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-difluorophenyl)alumane is sourced from PubChem (CID 175341718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).