About bis(2,6-difluorophenyl)phosphane;hydrochloride
bis(2,6-difluorophenyl)phosphane;hydrochloride (PubChem CID 175333360) has the molecular formula C12H8ClF4P
and a molecular weight of 294.62 g/mol. Its IUPAC name is bis(2,6-difluorophenyl)phosphane;hydrochloride.
Molecular Properties
| Compound Name | bis(2,6-difluorophenyl)phosphane;hydrochloride |
| PubChem CID | 175333360 |
| Molecular Formula | C12H8ClF4P |
| Molecular Weight | 294.62 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | bis(2,6-difluorophenyl)phosphane;hydrochloride |
| SMILES | Cl.Fc1cccc(F)c1Pc1c(F)cccc1F |
| InChI | InChI=1S/C12H7F4P.ClH/c13-7-3-1-4-8(14)11(7)17-12-9(15)5-2-6-10(12)16;/h1-6,17H;1H |
| InChIKey | CXRDGYUYCPRZPB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.62 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(2,6-difluorophenyl)phosphane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,6-difluorophenyl)phosphane;hydrochloride?
The IUPAC name of bis(2,6-difluorophenyl)phosphane;hydrochloride (CID 175333360) is bis(2,6-difluorophenyl)phosphane;hydrochloride.
What is the SMILES notation for bis(2,6-difluorophenyl)phosphane;hydrochloride?
The canonical SMILES for bis(2,6-difluorophenyl)phosphane;hydrochloride is Cl.Fc1cccc(F)c1Pc1c(F)cccc1F.
What is the InChIKey of bis(2,6-difluorophenyl)phosphane;hydrochloride?
The InChIKey is CXRDGYUYCPRZPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7F4P.ClH/c13-7-3-1-4-8(14)11(7)17-12-9(15)5-2-6-10(12)16;/h1-6,17H;1H.
What are the key properties of bis(2,6-difluorophenyl)phosphane;hydrochloride?
bis(2,6-difluorophenyl)phosphane;hydrochloride has a molecular weight of 294.62 g/mol, XLogP of 3.29, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,6-difluorophenyl)phosphane;hydrochloride is sourced from PubChem (CID 175333360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).