About 2,6-difluorophenolate
2,6-difluorophenolate (PubChem CID 18433948) has the molecular formula C6H3F2O-
and a molecular weight of 129.08 g/mol. Its IUPAC name is 2,6-difluorophenolate.
Molecular Properties
| Compound Name | 2,6-difluorophenolate |
| PubChem CID | 18433948 |
| Molecular Formula | C6H3F2O- |
| Molecular Weight | 129.08 g/mol |
| Exact Mass | 129.02 |
| IUPAC Name | 2,6-difluorophenolate |
| SMILES | [O-]c1c(F)cccc1F |
| InChI | InChI=1S/C6H4F2O/c7-4-2-1-3-5(8)6(4)9/h1-3,9H/p-1 |
| InChIKey | CKKOVFGIBXCEIJ-UHFFFAOYSA-M |
| XLogP | 1.04 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.08 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6-difluorophenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-difluorophenolate?
The IUPAC name of 2,6-difluorophenolate (CID 18433948) is 2,6-difluorophenolate.
What is the SMILES notation for 2,6-difluorophenolate?
The canonical SMILES for 2,6-difluorophenolate is [O-]c1c(F)cccc1F.
What is the InChIKey of 2,6-difluorophenolate?
The InChIKey is CKKOVFGIBXCEIJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H4F2O/c7-4-2-1-3-5(8)6(4)9/h1-3,9H/p-1.
What are the key properties of 2,6-difluorophenolate?
2,6-difluorophenolate has a molecular weight of 129.08 g/mol, XLogP of 1.04, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-difluorophenolate is sourced from PubChem (CID 18433948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).