C14H7F3 — CID 123788571
1,2,8-trifluorophenanthrene (PubChem CID 123788571) has the molecular formula C14H7F3 and a molecular weight of 232.20 g/mol. Its IUPAC name is 1,2,8-trifluorophenanthrene.
| Compound Name | 1,2,8-trifluorophenanthrene |
|---|---|
| PubChem CID | 123788571 |
| Molecular Formula | C14H7F3 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 1,2,8-trifluorophenanthrene |
| SMILES | Fc1ccc2c(ccc3c(F)cccc32)c1F |
| InChI | InChI=1S/C14H7F3/c15-12-3-1-2-8-9-6-7-13(16)14(17)11(9)5-4-10(8)12/h1-7H |
| InChIKey | PELDYWYYWGMKIX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|