C16H9Cl2F — CID 118818793
1-(2,5-dichlorophenyl)-5-fluoronaphthalene (PubChem CID 118818793) has the molecular formula C16H9Cl2F and a molecular weight of 291.15 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-5-fluoronaphthalene.
| Compound Name | 1-(2,5-dichlorophenyl)-5-fluoronaphthalene |
|---|---|
| PubChem CID | 118818793 |
| Molecular Formula | C16H9Cl2F |
| Molecular Weight | 291.15 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-5-fluoronaphthalene |
| SMILES | Fc1cccc2c(-c3cc(Cl)ccc3Cl)cccc12 |
| InChI | InChI=1S/C16H9Cl2F/c17-10-7-8-15(18)14(9-10)12-3-1-5-13-11(12)4-2-6-16(13)19/h1-9H |
| InChIKey | XLYSPITYGWLECM-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.15 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |