C13H8Cl2F2O — CID 119002522
1,4-dichloro-2-[2-(difluoromethoxy)phenyl]benzene (PubChem CID 119002522) has the molecular formula C13H8Cl2F2O and a molecular weight of 289.11 g/mol. Its IUPAC name is 1,4-dichloro-2-[2-(difluoromethoxy)phenyl]benzene.
| Compound Name | 1,4-dichloro-2-[2-(difluoromethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 119002522 |
| Molecular Formula | C13H8Cl2F2O |
| Molecular Weight | 289.11 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 1,4-dichloro-2-[2-(difluoromethoxy)phenyl]benzene |
| SMILES | FC(F)Oc1ccccc1-c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H8Cl2F2O/c14-8-5-6-11(15)10(7-8)9-3-1-2-4-12(9)18-13(16)17/h1-7,13H |
| InChIKey | GDDGDSNZVVAKHX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.11 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |