C12H7Cl2FO — CID 119000242
3-(2,5-dichlorophenyl)-2-fluorophenol (PubChem CID 119000242) has the molecular formula C12H7Cl2FO and a molecular weight of 257.09 g/mol. Its IUPAC name is 3-(2,5-dichlorophenyl)-2-fluorophenol.
| Compound Name | 3-(2,5-dichlorophenyl)-2-fluorophenol |
|---|---|
| PubChem CID | 119000242 |
| Molecular Formula | C12H7Cl2FO |
| Molecular Weight | 257.09 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | 3-(2,5-dichlorophenyl)-2-fluorophenol |
| SMILES | Oc1cccc(-c2cc(Cl)ccc2Cl)c1F |
| InChI | InChI=1S/C12H7Cl2FO/c13-7-4-5-10(14)9(6-7)8-2-1-3-11(16)12(8)15/h1-6,16H |
| InChIKey | BLTBJMXQSYCDOL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.09 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |