C16H8Cl3F — CID 118847360
1-fluoro-4-(2,3,4-trichlorophenyl)naphthalene (PubChem CID 118847360) has the molecular formula C16H8Cl3F and a molecular weight of 325.60 g/mol. Its IUPAC name is 1-fluoro-4-(2,3,4-trichlorophenyl)naphthalene.
| Compound Name | 1-fluoro-4-(2,3,4-trichlorophenyl)naphthalene |
|---|---|
| PubChem CID | 118847360 |
| Molecular Formula | C16H8Cl3F |
| Molecular Weight | 325.60 g/mol |
| Exact Mass | 323.97 |
| IUPAC Name | 1-fluoro-4-(2,3,4-trichlorophenyl)naphthalene |
| SMILES | Fc1ccc(-c2ccc(Cl)c(Cl)c2Cl)c2ccccc12 |
| InChI | InChI=1S/C16H8Cl3F/c17-13-7-5-12(15(18)16(13)19)10-6-8-14(20)11-4-2-1-3-9(10)11/h1-8H |
| InChIKey | USMORHWDLNFRCU-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.60 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|