C13H6Cl4F2O — CID 118849408
1,2,3-trichloro-4-[3-chloro-2-(difluoromethoxy)phenyl]benzene (PubChem CID 118849408) has the molecular formula C13H6Cl4F2O and a molecular weight of 358.00 g/mol. Its IUPAC name is 1,2,3-trichloro-4-[3-chloro-2-(difluoromethoxy)phenyl]benzene.
| Compound Name | 1,2,3-trichloro-4-[3-chloro-2-(difluoromethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 118849408 |
| Molecular Formula | C13H6Cl4F2O |
| Molecular Weight | 358.00 g/mol |
| Exact Mass | 355.91 |
| IUPAC Name | 1,2,3-trichloro-4-[3-chloro-2-(difluoromethoxy)phenyl]benzene |
| SMILES | FC(F)Oc1c(Cl)cccc1-c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H6Cl4F2O/c14-8-5-4-6(10(16)11(8)17)7-2-1-3-9(15)12(7)20-13(18)19/h1-5,13H |
| InChIKey | QVARYMRRNYDBMV-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.00 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|