About 1,2,5,8-tetrafluoronaphthalene
1,2,5,8-tetrafluoronaphthalene (PubChem CID 135202190) has the molecular formula C10H4F4
and a molecular weight of 200.13 g/mol. Its IUPAC name is 1,2,5,8-tetrafluoronaphthalene.
Molecular Properties
| Compound Name | 1,2,5,8-tetrafluoronaphthalene |
| PubChem CID | 135202190 |
| Molecular Formula | C10H4F4 |
| Molecular Weight | 200.13 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | 1,2,5,8-tetrafluoronaphthalene |
| SMILES | Fc1ccc2c(F)ccc(F)c2c1F |
| InChI | InChI=1S/C10H4F4/c11-6-3-4-7(12)9-5(6)1-2-8(13)10(9)14/h1-4H |
| InChIKey | HXPMRWKDSWYWLI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.13 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2,5,8-tetrafluoronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,5,8-tetrafluoronaphthalene?
The IUPAC name of 1,2,5,8-tetrafluoronaphthalene (CID 135202190) is 1,2,5,8-tetrafluoronaphthalene.
What is the SMILES notation for 1,2,5,8-tetrafluoronaphthalene?
The canonical SMILES for 1,2,5,8-tetrafluoronaphthalene is Fc1ccc2c(F)ccc(F)c2c1F.
What is the InChIKey of 1,2,5,8-tetrafluoronaphthalene?
The InChIKey is HXPMRWKDSWYWLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4F4/c11-6-3-4-7(12)9-5(6)1-2-8(13)10(9)14/h1-4H.
What are the key properties of 1,2,5,8-tetrafluoronaphthalene?
1,2,5,8-tetrafluoronaphthalene has a molecular weight of 200.13 g/mol, XLogP of 3.40, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,5,8-tetrafluoronaphthalene is sourced from PubChem (CID 135202190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).