C10H4F4 — CID 135202190
1,2,5,8-tetrafluoronaphthalene (PubChem CID 135202190) has the molecular formula C10H4F4 and a molecular weight of 200.13 g/mol. Its IUPAC name is 1,2,5,8-tetrafluoronaphthalene.
| Compound Name | 1,2,5,8-tetrafluoronaphthalene |
|---|---|
| PubChem CID | 135202190 |
| Molecular Formula | C10H4F4 |
| Molecular Weight | 200.13 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | 1,2,5,8-tetrafluoronaphthalene |
| SMILES | Fc1ccc2c(F)ccc(F)c2c1F |
| InChI | InChI=1S/C10H4F4/c11-6-3-4-7(12)9-5(6)1-2-8(13)10(9)14/h1-4H |
| InChIKey | HXPMRWKDSWYWLI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.13 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |