C18H10F2 — CID 14938397
1,4-difluorobenzo[c]phenanthrene (PubChem CID 14938397) has the molecular formula C18H10F2 and a molecular weight of 264.27 g/mol. Its IUPAC name is 1,4-difluorobenzo[c]phenanthrene.
| Compound Name | 1,4-difluorobenzo[c]phenanthrene |
|---|---|
| PubChem CID | 14938397 |
| Molecular Formula | C18H10F2 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 1,4-difluorobenzo[c]phenanthrene |
| SMILES | Fc1ccc(F)c2c1ccc1ccc3ccccc3c12 |
| InChI | InChI=1S/C18H10F2/c19-15-9-10-16(20)18-14(15)8-7-12-6-5-11-3-1-2-4-13(11)17(12)18/h1-10H |
| InChIKey | VGBSEWFDAGCUAY-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|