About 4-fluoropyrene
4-fluoropyrene (PubChem CID 15263498) has the molecular formula C16H9F
and a molecular weight of 220.25 g/mol. Its IUPAC name is 4-fluoropyrene.
Molecular Properties
| Compound Name | 4-fluoropyrene |
| PubChem CID | 15263498 |
| Molecular Formula | C16H9F |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 4-fluoropyrene |
| SMILES | Fc1cc2cccc3ccc4cccc1c4c32 |
| InChI | InChI=1S/C16H9F/c17-14-9-12-5-1-3-10-7-8-11-4-2-6-13(14)16(11)15(10)12/h1-9H |
| InChIKey | CZIKMWRETXSIHD-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoropyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoropyrene?
The IUPAC name of 4-fluoropyrene (CID 15263498) is 4-fluoropyrene.
What is the SMILES notation for 4-fluoropyrene?
The canonical SMILES for 4-fluoropyrene is Fc1cc2cccc3ccc4cccc1c4c32.
What is the InChIKey of 4-fluoropyrene?
The InChIKey is CZIKMWRETXSIHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9F/c17-14-9-12-5-1-3-10-7-8-11-4-2-6-13(14)16(11)15(10)12/h1-9H.
What are the key properties of 4-fluoropyrene?
4-fluoropyrene has a molecular weight of 220.25 g/mol, XLogP of 4.72, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoropyrene is sourced from PubChem (CID 15263498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).