About 1-chloro-2-fluoropyrene
1-chloro-2-fluoropyrene (PubChem CID 139789951) has the molecular formula C16H8ClF
and a molecular weight of 254.69 g/mol. Its IUPAC name is 1-chloro-2-fluoropyrene.
Molecular Properties
| Compound Name | 1-chloro-2-fluoropyrene |
| PubChem CID | 139789951 |
| Molecular Formula | C16H8ClF |
| Molecular Weight | 254.69 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 1-chloro-2-fluoropyrene |
| SMILES | Fc1cc2ccc3cccc4ccc(c1Cl)c2c34 |
| InChI | InChI=1S/C16H8ClF/c17-16-12-7-6-10-3-1-2-9-4-5-11(8-13(16)18)15(12)14(9)10/h1-8H |
| InChIKey | BVYRQXWFEZBTMA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.69 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-fluoropyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-fluoropyrene?
The IUPAC name of 1-chloro-2-fluoropyrene (CID 139789951) is 1-chloro-2-fluoropyrene.
What is the SMILES notation for 1-chloro-2-fluoropyrene?
The canonical SMILES for 1-chloro-2-fluoropyrene is Fc1cc2ccc3cccc4ccc(c1Cl)c2c34.
What is the InChIKey of 1-chloro-2-fluoropyrene?
The InChIKey is BVYRQXWFEZBTMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8ClF/c17-16-12-7-6-10-3-1-2-9-4-5-11(8-13(16)18)15(12)14(9)10/h1-8H.
What are the key properties of 1-chloro-2-fluoropyrene?
1-chloro-2-fluoropyrene has a molecular weight of 254.69 g/mol, XLogP of 5.38, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-fluoropyrene is sourced from PubChem (CID 139789951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).