C14H8Cl2 — CID 123462675
3,5-dichlorophenanthrene (PubChem CID 123462675) has the molecular formula C14H8Cl2 and a molecular weight of 247.12 g/mol. Its IUPAC name is 3,5-dichlorophenanthrene.
| Compound Name | 3,5-dichlorophenanthrene |
|---|---|
| PubChem CID | 123462675 |
| Molecular Formula | C14H8Cl2 |
| Molecular Weight | 247.12 g/mol |
| Exact Mass | 246.00 |
| IUPAC Name | 3,5-dichlorophenanthrene |
| SMILES | Clc1ccc2ccc3cccc(Cl)c3c2c1 |
| InChI | InChI=1S/C14H8Cl2/c15-11-7-6-9-4-5-10-2-1-3-13(16)14(10)12(9)8-11/h1-8H |
| InChIKey | IUXZLQGAKUYUDL-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.12 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|